cas: 948293-83-2 — see every product listed under this CAS number, including other names
5,7-Dichloroquinoline-3-carboxylic acid, 97% (CAS 948293-83-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A165715-5g |
| cas | 948293-83-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8702.26 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5,7-dichloroquinoline-3-carboxylic acid (CAS 948293-83-2) is a chemical compound with the molecular formula C10H5Cl2NO2 and a molecular weight of 242.05 g/mol. IUPAC name: 5,7-dichloroquinoline-3-carboxylic acid. InChIKey: KSVXPOMGBAOWQL-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO2 |
|---|---|
| Molecular weight | 242.05 g/mol |
| IUPAC name | 5,7-dichloroquinoline-3-carboxylic acid |
| InChIKey | KSVXPOMGBAOWQL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=CC(=C2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)