5,7-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%
cas: 1229784-79-5 — see every product listed under this CAS number, including other names
5,7-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97% (CAS 1229784-79-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A492464-250mg |
| cas | 1229784-79-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 1138.00 Pln | |
| Ambeed | 5g | 3819.13 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 842.00 Pln | |
| Chemat | 5g | 2786.00 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 375.45 Pln | |
| BLDpharm | 1g | 1225.15 Pln | |
| BLDpharm | 5g | 4107.47 Pln | |
| Fluorochem | 100mg | 180.16 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 1164.19 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5,7-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1229784-79-5) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 5,7-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: UEGKCSOJPKGCKX-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 5,7-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | UEGKCSOJPKGCKX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C(=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)
Synonyms:
5,7-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 5,7-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride, 5,7-Difluoro-2,3-dihydro-1H-inden-1-amine HCl, s10076, 5,7-difluoroindan-1-amine;hydrochloride, 1-Amino-5,7-difluoroindane Hydrochloride, 5,7-Difluoro-2,3-dihydro-1H-inden-1-aminehydrochloride