CAS 1260858-79-4 is the registry number for 3-(2,6-Difluorophenyl)azetidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,6-difluorophenyl)azetidine;hydrochloride (CAS 1260858-79-4) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 3-(2,6-difluorophenyl)azetidine;hydrochloride. InChIKey: WAJWAJCUFGDHBP-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 3-(2,6-difluorophenyl)azetidine;hydrochloride |
| InChIKey | WAJWAJCUFGDHBP-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=C(C=CC=C2F)F.Cl |
Computed by PubChem (NCBI)