5,8-Dibromoquinoline, 98%
cas: 81278-86-6 — see every product listed under this CAS number, including other names
5,8-Dibromoquinoline, 98% (CAS 81278-86-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A341493-1g |
| cas | 81278-86-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 25g | 737.50 Pln | |
| Ambeed | 100g | 2317.25 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 25g | 510.80 Pln | |
| Chemat | 100g | 1802.00 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 286.59 Pln | |
| BLDpharm | 25g | 786.41 Pln | |
| Fluorochem | 5g | 242.64 Pln | |
| Fluorochem | 25g | 742.46 Pln | |
| Fluorochem | 100g | 2273.18 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5,8-dibromoquinoline (CAS 81278-86-6) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 5,8-dibromoquinoline. InChIKey: LCSHATKNSDVDRY-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 5,8-dibromoquinoline |
| InChIKey | LCSHATKNSDVDRY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)Br)Br |
Computed by PubChem (NCBI)