5-(2,6-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 97%
cas: 89978-31-4 — see every product listed under this CAS number, including other names
5-(2,6-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 97% (CAS 89978-31-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A132871-250mg |
| cas | 89978-31-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 1710.94 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 158.86 Pln | |
| BLDpharm | 5g | 436.54 Pln | |
| BLDpharm | 25g | 1836.04 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 702.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-amine (CAS 89978-31-4) is a chemical compound with the molecular formula C8H5Cl2N3S and a molecular weight of 246.12 g/mol. IUPAC name: 5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: JWLOJTWDBWTXHD-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3S |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | JWLOJTWDBWTXHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=NN=C(S2)N)Cl |
Computed by PubChem (NCBI)