CAS 28004-63-9 appears in our catalog under these names: 5-(2,4-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 95%, 5–(2,4–Dichlorophenyl)–1,3,4–thiadiazol–2–amine, 5-(2,4-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 25g, 10g, 5g, 100mg.
5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-amine (CAS 28004-63-9) is a chemical compound with the molecular formula C8H5Cl2N3S and a molecular weight of 246.12 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: KNZULSYPOPMUED-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3S |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | KNZULSYPOPMUED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NN=C(S2)N |
Computed by PubChem (NCBI)