CAS 299443-17-7 appears in our catalog under these names: 5–(2,3–Dichlorophenyl)–1,3,4–thiadiazol–2–amine, 5-(2,3-Dichlorophenyl)-1,3,4-thiadiazol-2-amine 97%, 5-(2,3-Dichlorophenyl)-1,3,4-Thiadiazol-2-Amine, 97%, 97%, 5-(2,3-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
5-(2,3-dichlorophenyl)-1,3,4-thiadiazol-2-amine (CAS 299443-17-7) is a chemical compound with the molecular formula C8H5Cl2N3S and a molecular weight of 246.12 g/mol. IUPAC name: 5-(2,3-dichlorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: KJVBVESDMDDUKA-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3S |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 5-(2,3-dichlorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | KJVBVESDMDDUKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=NN=C(S2)N |
Computed by PubChem (NCBI)