CAS 735322-62-0 is the registry number for 5-(2,5-Dichlorophenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-(2,5-dichlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 735322-62-0) is a chemical compound with the molecular formula C8H5Cl2N3S and a molecular weight of 246.12 g/mol. IUPAC name: 5-(2,5-dichlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: NMMKMPMKLSTYQX-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3S |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 5-(2,5-dichlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | NMMKMPMKLSTYQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=NC(=S)NN2)Cl |
Computed by PubChem (NCBI)