CAS 26028-68-2 appears in our catalog under these names: 5-(2,4-Dichloro-phenyl)-4h-[1,2,4]triazole-3-thiol, 95%, 5-(2,4-dichlorophenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-(2,4-dichlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 26028-68-2) is a chemical compound with the molecular formula C8H5Cl2N3S and a molecular weight of 246.12 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: BZLULSOSPSQTAL-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3S |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | BZLULSOSPSQTAL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)