CAS 28004-64-0 appears in our catalog under these names: 5-(3,4-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 95%, 5–(3,4–Dichlorophenyl)–1,3,4–thiadiazol–2–amine, 5-(3,4-Dichlorophenyl)-1,3,4-thiadiazol-2-amine 95%, 5-(3,4-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 95%, 95%, 5-(3,4-Dichlorophenyl)-[1,3,4]-thiadiazol-2-ylamine, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 25g, 100g.
5-(3,4-dichlorophenyl)-1,3,4-thiadiazol-2-amine (CAS 28004-64-0) is a chemical compound with the molecular formula C8H5Cl2N3S and a molecular weight of 246.12 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: QNVGTVGYFLNBOG-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3S |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | QNVGTVGYFLNBOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NN=C(S2)N)Cl)Cl |
Computed by PubChem (NCBI)