Products 89978-31-4
CAS 89978-31-4 appears in our catalog under these names: 5-(2,6-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 95%, 5–(2，6–Dichlorophenyl)–1，3，4–thiadiazol–2–amine, 5-(2,6-Dichlorophenyl)-1,3,4-Thiadiazol-2-Amine, 5-(2,6-Dichlorophenyl)-1,3,4-Thiadiazol-2-Amine, 97%, 97%, 5-(2,6-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 97%(LC-MS),RG. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 25g.
5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-amine (CAS 89978-31-4) is a chemical compound with the molecular formula C8H5Cl2N3S and a molecular weight of 246.12 g/mol. IUPAC name: 5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: JWLOJTWDBWTXHD-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3S |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 5-(2,6-dichlorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | JWLOJTWDBWTXHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=NN=C(S2)N)Cl |
Computed by PubChem (NCBI)