CAS 2763157-80-6 is the registry number for 5,7-Dichloro-2-(methylthio)pyrido[2,3-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-2-methylsulfanylpyrido[2,3-d]pyrimidine (CAS 2763157-80-6) is a chemical compound with the molecular formula C8H5Cl2N3S and a molecular weight of 246.12 g/mol. IUPAC name: 5,7-dichloro-2-methylsulfanylpyrido[2,3-d]pyrimidine. InChIKey: SGOYHFDIBKIGCP-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3S |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 5,7-dichloro-2-methylsulfanylpyrido[2,3-d]pyrimidine |
| InChIKey | SGOYHFDIBKIGCP-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C(=CC(=NC2=N1)Cl)Cl |
Computed by PubChem (NCBI)