CAS 70057-64-6 appears in our catalog under these names: 5-(3,5-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 95%, 5-(3,5-Dichlorophenyl)-1,3,4-thiadiazol-2-amine, 97%, 5-(3,5-Dichlorophenyl)-1,3,4-thiadiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
5-(3,5-dichlorophenyl)-1,3,4-thiadiazol-2-amine (CAS 70057-64-6) is a chemical compound with the molecular formula C8H5Cl2N3S and a molecular weight of 246.12 g/mol. IUPAC name: 5-(3,5-dichlorophenyl)-1,3,4-thiadiazol-2-amine. InChIKey: GIBHWYSZYWWWRJ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3S |
|---|---|
| Molecular weight | 246.12 g/mol |
| IUPAC name | 5-(3,5-dichlorophenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | GIBHWYSZYWWWRJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=NN=C(S2)N |
Computed by PubChem (NCBI)