cas: 1375064-55-3 — see every product listed under this CAS number, including other names
5-(2-Pyrazinyl)isoxazole-3-carboxylic Acid, >95%, >95% (CAS 1375064-55-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124F4-100mg |
| cas | 1375064-55-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 549.20 Pln | |
| Chemat | 250mg | 640.40 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
5-pyrazin-2-yl-1,2-oxazole-3-carboxylic acid (CAS 1375064-55-3) is a chemical compound with the molecular formula C8H5N3O3 and a molecular weight of 191.14 g/mol. IUPAC name: 5-pyrazin-2-yl-1,2-oxazole-3-carboxylic acid. InChIKey: LGEIAXHZEBTDSN-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O3 |
|---|---|
| Molecular weight | 191.14 g/mol |
| IUPAC name | 5-pyrazin-2-yl-1,2-oxazole-3-carboxylic acid |
| InChIKey | LGEIAXHZEBTDSN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)