cas: 71217-46-4 — see every product listed under this CAS number, including other names
5-(Isocyanatomethyl)-1,3-benzodioxole, 97% (CAS 71217-46-4) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC50806CB |
| cas | 71217-46-4 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 773.80 Pln | |
| Thermo Scientific | 1g | 1929.41 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
5-(isocyanatomethyl)-1,3-benzodioxole (CAS 71217-46-4) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 5-(isocyanatomethyl)-1,3-benzodioxole. InChIKey: RIUNOJGBBOBVDE-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-(isocyanatomethyl)-1,3-benzodioxole |
| InChIKey | RIUNOJGBBOBVDE-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CN=C=O |
Computed by PubChem (NCBI)