cas: 71217-46-4 — see every product listed under this CAS number, including other names
5-(Isocyanatomethyl)-2H-1,3-benzodioxole, 95% (CAS 71217-46-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1040723-5g |
| cas | 71217-46-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15049.51 Pln | |
| AmBeed | 10g | 21481.39 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(isocyanatomethyl)-1,3-benzodioxole (CAS 71217-46-4) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 5-(isocyanatomethyl)-1,3-benzodioxole. InChIKey: RIUNOJGBBOBVDE-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-(isocyanatomethyl)-1,3-benzodioxole |
| InChIKey | RIUNOJGBBOBVDE-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CN=C=O |
Computed by PubChem (NCBI)