cas: 1016494-31-7 — see every product listed under this CAS number, including other names
5-(Naphthalen-1-yl)-1,3,4-oxadiazol-2-amine, 95% (CAS 1016494-31-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1108605-5g |
| cas | 1016494-31-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11495.05 Pln | |
| AmBeed | 10g | 17842.30 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-naphthalen-1-yl-1,3,4-oxadiazol-2-amine (CAS 1016494-31-7) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 5-naphthalen-1-yl-1,3,4-oxadiazol-2-amine. InChIKey: VYISJPAVHRPXIH-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5-naphthalen-1-yl-1,3,4-oxadiazol-2-amine |
| InChIKey | VYISJPAVHRPXIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NN=C(O3)N |
Computed by PubChem (NCBI)