cas: 57603-82-4 — see every product listed under this CAS number, including other names
5-(Pyrimidin-2-ylthio)furan-2-carbaldehyde 97% (CAS 57603-82-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A807413-250mg |
| cas | 57603-82-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 987.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A807413 |
5-pyrimidin-2-ylsulfanylfuran-2-carbaldehyde (CAS 57603-82-4) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 5-pyrimidin-2-ylsulfanylfuran-2-carbaldehyde. InChIKey: BVGQOPQJOBCDBN-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 5-pyrimidin-2-ylsulfanylfuran-2-carbaldehyde |
| InChIKey | BVGQOPQJOBCDBN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)SC2=CC=C(O2)C=O |
Computed by PubChem (NCBI)