cas: 1174322-64-5 — see every product listed under this CAS number, including other names
5-(Thiazol-2-yl)picolinic acid, 95%, 95% (CAS 1174322-64-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1107IW-100mg |
| cas | 1174322-64-5 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1005.20 Pln | |
| Chemat | 250mg | 1662.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid (CAS 1174322-64-5) is a chemical compound with the molecular formula C9H6N2O2S and a molecular weight of 206.22 g/mol. IUPAC name: 5-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid. InChIKey: WYXFCAVXHLKGLU-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2S |
|---|---|
| Molecular weight | 206.22 g/mol |
| IUPAC name | 5-(1,3-thiazol-2-yl)pyridine-2-carboxylic acid |
| InChIKey | WYXFCAVXHLKGLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=NC=CS2)C(=O)O |
Computed by PubChem (NCBI)