5-Bromoisoquinoline, 96%
cas: 34784-04-8 — see every product listed under this CAS number, including other names
5-Bromoisoquinoline, 96% (CAS 34784-04-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038557-1G |
| cas | 34784-04-8 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 112.48 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 100g | 476.93 Pln | |
| Fluorochem | 500g | 1893.10 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
5-bromoisoquinoline (CAS 34784-04-8) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 5-bromoisoquinoline. InChIKey: CYJZJGYYTFQQBY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 5-bromoisoquinoline |
| InChIKey | CYJZJGYYTFQQBY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)Br |
Computed by PubChem (NCBI)