5-Bromoisoquinoline, 99.95%
cas: 34784-04-8 — see every product listed under this CAS number, including other names
5-Bromoisoquinoline, 99.95% (CAS 34784-04-8) is a chemical reagent available from Chemat. Available pack sizes: 500 mg, 50 g, 250 g, 100 g, 25 g, 1 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W007854-500 mg |
| cas | 34784-04-8 |
| size | 500 mg |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 mg | 240.74 Pln | |
| MedChemExpress | 50 g | 2000.82 Pln | |
| MedChemExpress | 250 g | 3997.74 Pln | |
| MedChemExpress | 100 g | 2567.39 Pln | |
| MedChemExpress | 25 g | 1462.12 Pln | |
| MedChemExpress | 1 g | 310.40 Pln | |
| MedChemExpress | 10 g | 909.48 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.95% |
5-bromoisoquinoline (CAS 34784-04-8) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 5-bromoisoquinoline. InChIKey: CYJZJGYYTFQQBY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 5-bromoisoquinoline |
| InChIKey | CYJZJGYYTFQQBY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)Br |
Computed by PubChem (NCBI)