cas: 4964-71-0 — see every product listed under this CAS number, including other names
5-Bromoquinoline, 97%, 97% (CAS 4964-71-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MKZ-1g |
| cas | 4964-71-0 |
| size | 1g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 203.60 Pln | |
| Chemat | 100g | 630.80 Pln | |
| Chemat | 500g | 2976.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromoquinoline (CAS 4964-71-0) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 5-bromoquinoline. InChIKey: CHODTZCXWXCALP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 5-bromoquinoline |
| InChIKey | CHODTZCXWXCALP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=N2)C(=C1)Br |
Computed by PubChem (NCBI)