cas: 1255099-52-5 — see every product listed under this CAS number, including other names
5-CHLORO-2-(METHYLTHIO)PYRIDO[4,3-D]PYRIMIDINE, 96% (CAS 1255099-52-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F301198-100MG |
| cas | 1255099-52-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 799.74 Pln | |
| Fluorochem | 1g | 1997.23 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-2-methylsulfanylpyrido[4,3-d]pyrimidine (CAS 1255099-52-5) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 5-chloro-2-methylsulfanylpyrido[4,3-d]pyrimidine. InChIKey: PLQLDJOSXAPLFB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 5-chloro-2-methylsulfanylpyrido[4,3-d]pyrimidine |
| InChIKey | PLQLDJOSXAPLFB-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C(=N1)C=CN=C2Cl |
Computed by PubChem (NCBI)