5-Chloro-2-Nitrobenzenesulfonyl chloride, 97%
cas: 21792-87-0 — see every product listed under this CAS number, including other names
5-Chloro-2-Nitrobenzenesulfonyl chloride, 97% (CAS 21792-87-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11C52E-100mg |
| cas | 21792-87-0 |
| size | 100mg |
| availability | 3g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 381.20 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1138.16 Pln | |
| Fluorochem | 10g | 2184.66 Pln | |
| Fluorochem | 25g | 5246.09 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2-nitrobenzenesulfonyl chloride (CAS 21792-87-0) is a chemical compound with the molecular formula C6H3Cl2NO4S and a molecular weight of 256.06 g/mol. IUPAC name: 5-chloro-2-nitrobenzenesulfonyl chloride. InChIKey: LNNFIOQFBJVJMZ-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO4S |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 5-chloro-2-nitrobenzenesulfonyl chloride |
| InChIKey | LNNFIOQFBJVJMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)