cas: 2007919-15-3 — see every product listed under this CAS number, including other names
5-Chloro-6-nitroindoline, 95%, 95% (CAS 2007919-15-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CZQ-100mg |
| cas | 2007919-15-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 500mg | 520.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-chloro-6-nitro-2,3-dihydro-1H-indole (CAS 2007919-15-3) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 5-chloro-6-nitro-2,3-dihydro-1H-indole. InChIKey: SOMADCPMWAGDKT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 5-chloro-6-nitro-2,3-dihydro-1H-indole |
| InChIKey | SOMADCPMWAGDKT-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C21)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)