CAS 813425-06-8 is the registry number for 6-Amino-8-chloro-2h-1,4-benzoxazin-3(4h)-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-amino-8-chloro-4H-1,4-benzoxazin-3-one (CAS 813425-06-8) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 6-amino-8-chloro-4H-1,4-benzoxazin-3-one. InChIKey: VSFNECHUKMCBAY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 6-amino-8-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | VSFNECHUKMCBAY-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=CC(=C2)N)Cl |
Computed by PubChem (NCBI)