CAS 1042973-67-0 appears in our catalog under these names: 8-Amino-6-chloro-4h-benzo[1,4]oxazin-3-one, 98%, 8-Amino-6-chloro-2H-benzo(b)(1,4)oxazin-3(4H)-one, 98%, 8-Amino-6-chloro-4H-benzo(1,4)oxazin-3-one, 8-Amino-6-chloro-4h-benzo[1,4]oxazin-3-one, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
8-amino-6-chloro-4H-1,4-benzoxazin-3-one (CAS 1042973-67-0) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 8-amino-6-chloro-4H-1,4-benzoxazin-3-one. InChIKey: LFQDPHSIICCBLE-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 8-amino-6-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | LFQDPHSIICCBLE-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC(=CC(=C2O1)N)Cl |
Computed by PubChem (NCBI)