CAS 860363-17-3 appears in our catalog under these names: 1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid hydrochloride, 95%, 1H-Pyrrolo(3,2-b)pyridine-3-carboxylic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g.
1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid;hydrochloride (CAS 860363-17-3) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid;hydrochloride. InChIKey: FOTTVLODUOHKPQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | FOTTVLODUOHKPQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN2)C(=O)O)N=C1.Cl |
Computed by PubChem (NCBI)