CAS 40401-45-4 appears in our catalog under these names: 7-Amino-6-chloro-2h-1,4-benzoxazin-3(4h)-one, 95%, 7-Amino-6-chloro-2H-benzo(b)(1,4)oxazin-3(4H)-one, 95+%, 7-Amino-6-chloro-4H-benzo(1,4)oxazin-3-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 250mg, 1g, 2,5g.
7-amino-6-chloro-4H-1,4-benzoxazin-3-one (CAS 40401-45-4) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 7-amino-6-chloro-4H-1,4-benzoxazin-3-one. InChIKey: RXHIJDUZDJCOAG-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 7-amino-6-chloro-4H-1,4-benzoxazin-3-one |
| InChIKey | RXHIJDUZDJCOAG-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C(=C2)Cl)N |
Computed by PubChem (NCBI)