CAS 1158444-99-5 appears in our catalog under these names: Benzodiazole-5-carboxylic acid hydrochloride, 96%, Benzodiazole-5-carboxylic acid HCl, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 100g, 500g.
3H-benzimidazole-5-carboxylic acid;hydrochloride (CAS 1158444-99-5) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 3H-benzimidazole-5-carboxylic acid;hydrochloride. InChIKey: DDMPIPCSFLSDEX-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 3H-benzimidazole-5-carboxylic acid;hydrochloride |
| InChIKey | DDMPIPCSFLSDEX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC=N2.Cl |
Computed by PubChem (NCBI)