Products 915139-44-5

CAS 915139-44-5 is the registry number for 5-Carboxyindazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

1H-indazole-5-carboxylic acid;hydrochloride (CAS 915139-44-5) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 1H-indazole-5-carboxylic acid;hydrochloride. InChIKey: GWFPHPWZNDFVJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClN2O2
Molecular weight198.60 g/mol
IUPAC name1H-indazole-5-carboxylic acid;hydrochloride
InChIKeyGWFPHPWZNDFVJJ-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C(=O)O)C=NN2.Cl

Computed by PubChem (NCBI)