CAS 915139-44-5 is the registry number for 5-Carboxyindazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1H-indazole-5-carboxylic acid;hydrochloride (CAS 915139-44-5) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 1H-indazole-5-carboxylic acid;hydrochloride. InChIKey: GWFPHPWZNDFVJJ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 1H-indazole-5-carboxylic acid;hydrochloride |
| InChIKey | GWFPHPWZNDFVJJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C=NN2.Cl |
Computed by PubChem (NCBI)