CAS 172078-32-9 appears in our catalog under these names: 6-Chloro-5-nitro-2,3-dihydro-1h-indole, 95%, 6-Chloro-5-nitroindoline, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
6-chloro-5-nitro-2,3-dihydro-1H-indole (CAS 172078-32-9) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 6-chloro-5-nitro-2,3-dihydro-1H-indole. InChIKey: HTTPYSPFYDKFME-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 6-chloro-5-nitro-2,3-dihydro-1H-indole |
| InChIKey | HTTPYSPFYDKFME-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C21)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)