Products 2007919-15-3
CAS 2007919-15-3 appears in our catalog under these names: 5-Chloro-6-nitro-2,3-dihydro-1h-indole, 95%, 5-Chloro-6-nitroindoline, 97%, 5-Chloro-6-nitroindoline, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 500mg.
5-chloro-6-nitro-2,3-dihydro-1H-indole (CAS 2007919-15-3) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 5-chloro-6-nitro-2,3-dihydro-1H-indole. InChIKey: SOMADCPMWAGDKT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 5-chloro-6-nitro-2,3-dihydro-1H-indole |
| InChIKey | SOMADCPMWAGDKT-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C21)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)