5-Cyano-2-fluorobenzoic acid 98%
cas: 146328-87-2 — see every product listed under this CAS number, including other names
5-Cyano-2-fluorobenzoic acid 98% (CAS 146328-87-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A197418-1g |
| cas | 146328-87-2 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 659.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A197418 |
5-cyano-2-fluorobenzoic acid (CAS 146328-87-2) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 5-cyano-2-fluorobenzoic acid. InChIKey: UQXVUTYCTZULCD-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 5-cyano-2-fluorobenzoic acid |
| InChIKey | UQXVUTYCTZULCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(=O)O)F |
Computed by PubChem (NCBI)