5-Fluoro-2-(trifluoromethoxy)benzoic acid, 98%
cas: 1092460-83-7 — see every product listed under this CAS number, including other names
5-Fluoro-2-(trifluoromethoxy)benzoic acid, 98% (CAS 1092460-83-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A480842-100mg |
| cas | 1092460-83-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 832.06 Pln | |
| Ambeed | 25g | 3090.44 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 197.73 Pln | |
| BLDpharm | 1g | 258.82 Pln | |
| BLDpharm | 5g | 891.93 Pln | |
| BLDpharm | 25g | 3329.96 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-fluoro-2-(trifluoromethoxy)benzoic acid (CAS 1092460-83-7) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 5-fluoro-2-(trifluoromethoxy)benzoic acid. InChIKey: JRQMLAPRSGFPRF-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 5-fluoro-2-(trifluoromethoxy)benzoic acid |
| InChIKey | JRQMLAPRSGFPRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)