CAS 67765-42-8 appears in our catalog under these names: 5-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 98%, 5–Methoxy–1H–benzo(d)(1,3)oxazine–2,4–dione, 5-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
5-methoxy-1H-3,1-benzoxazine-2,4-dione (CAS 67765-42-8) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 5-methoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: KIZGBTDENGRWRS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 5-methoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | KIZGBTDENGRWRS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)