6,7-Dibromoquinoxaline, 97%
cas: 1902152-20-8 — see every product listed under this CAS number, including other names
6,7-Dibromoquinoxaline, 97% (CAS 1902152-20-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1002552-250mg |
| cas | 1902152-20-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2111.44 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2274.78 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 774.80 Pln | |
| Chemat | 5g | 2613.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
6,7-dibromoquinoxaline (CAS 1902152-20-8) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 6,7-dibromoquinoxaline. InChIKey: UYFYNKCGCHMTQG-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 6,7-dibromoquinoxaline |
| InChIKey | UYFYNKCGCHMTQG-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C(=CC2=N1)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
6,7-Dibromoquinoxaline, Quinoxaline, 6,7-dibromo-