cas: 1092349-93-3 — see every product listed under this CAS number, including other names
6,7-Difluorochroman-4-one, 98%, 98% (CAS 1092349-93-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119UGX-100mg |
| cas | 1092349-93-3 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 568.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6,7-difluoro-2,3-dihydrochromen-4-one (CAS 1092349-93-3) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 6,7-difluoro-2,3-dihydrochromen-4-one. InChIKey: WGCSANGNQYZBTQ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 6,7-difluoro-2,3-dihydrochromen-4-one |
| InChIKey | WGCSANGNQYZBTQ-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2C1=O)F)F |
Computed by PubChem (NCBI)