CAS 844648-22-2 appears in our catalog under these names: Tegoprazan Impurity 10, 5,7-Difluorochroman-4-one, 5,7–Difluorochroman–4–one, 5,7-difluoro-2,3-dihydrochromen-4-one, 5,7-Difluorochroman-4-one 97%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 25mg, 1g, 250mg, 25g, 10g, 100mg, 5g.
5,7-difluoro-2,3-dihydrochromen-4-one (CAS 844648-22-2) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 5,7-difluoro-2,3-dihydrochromen-4-one. InChIKey: OJVRCPGUGZXUAP-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 5,7-difluoro-2,3-dihydrochromen-4-one |
| InChIKey | OJVRCPGUGZXUAP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)