CAS 1521718-28-4 is the registry number for 6,8-Difluorochroman-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-difluoro-3,4-dihydrochromen-2-one (CAS 1521718-28-4) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 6,8-difluoro-3,4-dihydrochromen-2-one. InChIKey: DVXMOQDYUZIDNH-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 6,8-difluoro-3,4-dihydrochromen-2-one |
| InChIKey | DVXMOQDYUZIDNH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)OC2=C1C=C(C=C2F)F |
Computed by PubChem (NCBI)