cas: 383132-13-6 — see every product listed under this CAS number, including other names
6,7-DICHLORO-1H-INDOLE-2-CARBOXYLIC ACID, 98%, 98% (CAS 383132-13-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYNE-100mg |
| cas | 383132-13-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 1744.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6,7-dichloro-1H-indole-2-carboxylic acid (CAS 383132-13-6) is a chemical compound with the molecular formula C9H5Cl2NO2 and a molecular weight of 230.04 g/mol. IUPAC name: 6,7-dichloro-1H-indole-2-carboxylic acid. InChIKey: TUXCSCQQWQOWDU-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO2 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 6,7-dichloro-1H-indole-2-carboxylic acid |
| InChIKey | TUXCSCQQWQOWDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=C(N2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)