cas: 39549-31-0 — see every product listed under this CAS number, including other names
6-Amino-2,4-dichloro-3-methylphenol Hydrochloride, 98.0%, 98.0% (CAS 39549-31-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N39-5g |
| cas | 39549-31-0 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 232.40 Pln | |
| Chemat | 25g | 712.40 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
6-amino-2,4-dichloro-3-methylphenol;hydrochloride (CAS 39549-31-0) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: 6-amino-2,4-dichloro-3-methylphenol;hydrochloride. InChIKey: ZOQYQHLEDJOHOK-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | 6-amino-2,4-dichloro-3-methylphenol;hydrochloride |
| InChIKey | ZOQYQHLEDJOHOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Cl)O)N)Cl.Cl |
Computed by PubChem (NCBI)