cas: 26673-31-4 — see every product listed under this CAS number, including other names
6-Chloro-1-tetralone, >96.0%(GC) (CAS 26673-31-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C2917-1G |
| cas | 26673-31-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 231.44 Pln | |
| TCI | 5g | 772.34 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(GC) |
6-chloro-3,4-dihydro-2H-naphthalen-1-one (CAS 26673-31-4) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: WQKHERPPDYPMNX-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | WQKHERPPDYPMNX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=O)C1 |
Computed by PubChem (NCBI)