cas: 26673-31-4 — see every product listed under this CAS number, including other names
6-Chloro-3,4-dihydronaphthalen-1(2H)-one, 98%, 98% (CAS 26673-31-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I62Q-100mg |
| cas | 26673-31-4 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 405.20 Pln | |
| Chemat | 100g | 1427.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-chloro-3,4-dihydro-2H-naphthalen-1-one (CAS 26673-31-4) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: WQKHERPPDYPMNX-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | WQKHERPPDYPMNX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=O)C1 |
Computed by PubChem (NCBI)