cas: 26673-31-4 — see every product listed under this CAS number, including other names
6-Chloro-3,4-dihydronaphthalen-1(2H)-one, 95% (CAS 26673-31-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240405-250MG |
| cas | 26673-31-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 539.41 Pln | |
| Fluorochem | 100g | 1981.61 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-chloro-3,4-dihydro-2H-naphthalen-1-one (CAS 26673-31-4) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: WQKHERPPDYPMNX-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | WQKHERPPDYPMNX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=O)C1 |
Computed by PubChem (NCBI)