6-Chloro-1h-indole-5-carboxylic acid, 95%
cas: 256935-86-1 — see every product listed under this CAS number, including other names
6-Chloro-1h-indole-5-carboxylic acid, 95% (CAS 256935-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Combi-blocks, Ambeed, BLDpharm, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QK-2209-100mg |
| cas | 256935-86-1 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 598.44 Pln | |
| Ambeed | 5g | 2089.19 Pln | |
| Ambeed | 25g | 10160.38 Pln | |
| BLDpharm | 100mg | 181.07 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 642.02 Pln | |
| BLDpharm | 5g | 2247.01 Pln | |
| BLDpharm | 25g | 10949.50 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 1288.40 Pln | |
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 617.51 Pln | |
| Fluorochem | 5g | 2148.22 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
6-chloro-1H-indole-5-carboxylic acid (CAS 256935-86-1) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 6-chloro-1H-indole-5-carboxylic acid. InChIKey: PNQNYTQRGUBNTG-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 6-chloro-1H-indole-5-carboxylic acid |
| InChIKey | PNQNYTQRGUBNTG-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=C(C=C21)C(=O)O)Cl |
Computed by PubChem (NCBI)