CAS 15952-61-1 appears in our catalog under these names: 6-Chloropiperonal, 95%, 6-Chloropiperonal/ 98%, 6-Chlorobenzo[d][1,3]dioxole-5-carbaldehyde, 98%, 98%, 6-chloro-1,3-benzodioxole-5-carbaldehyde, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
6-chloro-1,3-benzodioxole-5-carbaldehyde (CAS 15952-61-1) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 6-chloro-1,3-benzodioxole-5-carbaldehyde. InChIKey: VRNADRCOROWLJC-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 6-chloro-1,3-benzodioxole-5-carbaldehyde |
| InChIKey | VRNADRCOROWLJC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C=O)Cl |
Computed by PubChem (NCBI)