cas: 324-03-8 — see every product listed under this CAS number, including other names
6-FLUOROISATIN, 97%, 97% (CAS 324-03-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145D2-250mg |
| cas | 324-03-8 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 242.00 Pln | |
| Chemat | 100g | 789.20 Pln | |
| Chemat | 500g | 3033.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-fluoro-1H-indole-2,3-dione (CAS 324-03-8) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 6-fluoro-1H-indole-2,3-dione. InChIKey: CWVFOAVBTUHQCZ-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 6-fluoro-1H-indole-2,3-dione |
| InChIKey | CWVFOAVBTUHQCZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)C2=O |
Computed by PubChem (NCBI)