cas: 324-03-8 — see every product listed under this CAS number, including other names
6-Fluoroisatin, 95% (CAS 324-03-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | ST-6055-5g |
| cas | 324-03-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 159.34 Pln | |
| Fluorochem | 25g | 315.53 Pln | |
| Fluorochem | 100g | 1080.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
6-fluoro-1H-indole-2,3-dione (CAS 324-03-8) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 6-fluoro-1H-indole-2,3-dione. InChIKey: CWVFOAVBTUHQCZ-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 6-fluoro-1H-indole-2,3-dione |
| InChIKey | CWVFOAVBTUHQCZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=O)C2=O |
Computed by PubChem (NCBI)