cas: 92028-21-2 — see every product listed under this CAS number, including other names
6-Methoxy-[1,1'-biphenyl]-3-amine hydrochloride 95% (CAS 92028-21-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A258275-1g |
| cas | 92028-21-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 526.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A258275 |
4-methoxy-3-phenylaniline;hydrochloride (CAS 92028-21-2) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 4-methoxy-3-phenylaniline;hydrochloride. InChIKey: ONIVGWWTHRIXHL-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 4-methoxy-3-phenylaniline;hydrochloride |
| InChIKey | ONIVGWWTHRIXHL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)